C27H46N6O12 — CID 175827737
(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminohexanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 175827737) has the molecular formula C27H46N6O12 and a molecular weight of 646.70 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminohexanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminohexanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175827737 |
| Molecular Formula | C27H46N6O12 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.32 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminohexanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](N)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C27H46N6O12/c1-2-3-6-15(29)23(40)30-16(8-11-20(34)35)24(41)31-17(9-12-21(36)37)25(42)32-18(10-13-22(38)39)26(43)33-19(27(44)45)7-4-5-14-28/h15-19H,2-14,28-29H2,1H3,(H,30,40)(H,31,41)(H,32,42)(H,33,43)(H,34,35)(H,36,37)(H,38,39)(H,44,45)/t15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | ZZKNOSMZKJJXJD-VMXHOPILSA-N |
| XLogP | -1.75 |
| TPSA | 317.64 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|