C21H33N5O6S — CID 19067714
6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid (PubChem CID 19067714) has the molecular formula C21H33N5O6S and a molecular weight of 483.59 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19067714 |
| Molecular Formula | C21H33N5O6S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
| SMILES | CC(N)C(=O)NC(CS)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C21H33N5O6S/c1-12(23)18(28)26-17(11-33)20(30)25-16(10-13-5-7-14(27)8-6-13)19(29)24-15(21(31)32)4-2-3-9-22/h5-8,12,15-17,27,33H,2-4,9-11,22-23H2,1H3,(H,24,29)(H,25,30)(H,26,28)(H,31,32) |
| InChIKey | JCUIOHYESACFGX-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|