C17H15NO2S — CID 25437940
5-methyl-N-[(S)-phenyl(thiophen-2-yl)methyl]furan-2-carboxamide (PubChem CID 25437940) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is 5-methyl-N-[(S)-phenyl(thiophen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | 5-methyl-N-[(S)-phenyl(thiophen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 25437940 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 5-methyl-N-[(S)-phenyl(thiophen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N[C@@H](c2ccccc2)c2cccs2)o1 |
| InChI | InChI=1S/C17H15NO2S/c1-12-9-10-14(20-12)17(19)18-16(15-8-5-11-21-15)13-6-3-2-4-7-13/h2-11,16H,1H3,(H,18,19)/t16-/m0/s1 |
| InChIKey | NPWCKJFLTFTGFS-INIZCTEOSA-N |
| XLogP | 4.17 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |