C13H10F3NOS — CID 62733554
2,2,2-trifluoro-N-[phenyl(thiophen-2-yl)methyl]acetamide (PubChem CID 62733554) has the molecular formula C13H10F3NOS and a molecular weight of 285.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[phenyl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[phenyl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 62733554 |
| Molecular Formula | C13H10F3NOS |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2,2,2-trifluoro-N-[phenyl(thiophen-2-yl)methyl]acetamide |
| SMILES | O=C(NC(c1ccccc1)c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C13H10F3NOS/c14-13(15,16)12(18)17-11(10-7-4-8-19-10)9-5-2-1-3-6-9/h1-8,11H,(H,17,18) |
| InChIKey | NMVHXLRPKCQMTG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |