C25H22N2O2S — CID 3780877
2-hydroxy-2,2-diphenyl-N'-[phenyl(thiophen-2-yl)methyl]acetohydrazide (PubChem CID 3780877) has the molecular formula C25H22N2O2S and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-hydroxy-2,2-diphenyl-N'-[phenyl(thiophen-2-yl)methyl]acetohydrazide.
| Compound Name | 2-hydroxy-2,2-diphenyl-N'-[phenyl(thiophen-2-yl)methyl]acetohydrazide |
|---|---|
| PubChem CID | 3780877 |
| Molecular Formula | C25H22N2O2S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-hydroxy-2,2-diphenyl-N'-[phenyl(thiophen-2-yl)methyl]acetohydrazide |
| SMILES | O=C(NNC(c1ccccc1)c1cccs1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O2S/c28-24(25(29,20-13-6-2-7-14-20)21-15-8-3-9-16-21)27-26-23(22-17-10-18-30-22)19-11-4-1-5-12-19/h1-18,23,26,29H,(H,27,28) |
| InChIKey | HNRFIKHOBLVPNU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|