C29H28N2O4 — CID 3137826
N'-[(3,4-dimethoxyphenyl)-phenylmethyl]-2-hydroxy-2,2-diphenylacetohydrazide (PubChem CID 3137826) has the molecular formula C29H28N2O4 and a molecular weight of 468.55 g/mol. Its IUPAC name is N'-[(3,4-dimethoxyphenyl)-phenylmethyl]-2-hydroxy-2,2-diphenylacetohydrazide.
| Compound Name | N'-[(3,4-dimethoxyphenyl)-phenylmethyl]-2-hydroxy-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 3137826 |
| Molecular Formula | C29H28N2O4 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | N'-[(3,4-dimethoxyphenyl)-phenylmethyl]-2-hydroxy-2,2-diphenylacetohydrazide |
| SMILES | COc1ccc(C(NNC(=O)C(O)(c2ccccc2)c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C29H28N2O4/c1-34-25-19-18-22(20-26(25)35-2)27(21-12-6-3-7-13-21)30-31-28(32)29(33,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-20,27,30,33H,1-2H3,(H,31,32) |
| InChIKey | AAIPABZBZYFUCI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|