About 3-(3,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylpropanoic acid
3-(3,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylpropanoic acid (PubChem CID 62398262) has the molecular formula C13H18O5
and a molecular weight of 254.28 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylpropanoic acid.
Analyze 3-(3,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(3,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylpropanoic acid (CID 62398262) is 3-(3,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(3,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(3,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylpropanoic acid is COc1ccc(C(O)C(C)(C)C(=O)O)cc1OC.
What is the InChIKey of 3-(3,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylpropanoic acid?
The InChIKey is NLOSOCMVKHGPQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O5/c1-13(2,12(15)16)11(14)8-5-6-9(17-3)10(7-8)18-4/h5-7,11,14H,1-4H3,(H,15,16).
What are the key properties of 3-(3,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylpropanoic acid?
3-(3,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylpropanoic acid has a molecular weight of 254.28 g/mol, XLogP of 1.85, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethoxyphenyl)-3-hydroxy-2,2-dimethylpropanoic acid is sourced from PubChem (CID 62398262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).