C13H17O9P — CID 21478378
3-(3,4-dimethoxyphenyl)-2-methyl-2-phosphonobutanedioic acid (PubChem CID 21478378) has the molecular formula C13H17O9P and a molecular weight of 348.24 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-methyl-2-phosphonobutanedioic acid.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-methyl-2-phosphonobutanedioic acid |
|---|---|
| PubChem CID | 21478378 |
| Molecular Formula | C13H17O9P |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-methyl-2-phosphonobutanedioic acid |
| SMILES | COc1ccc(C(C(=O)O)C(C)(C(=O)O)P(=O)(O)O)cc1OC |
| InChI | InChI=1S/C13H17O9P/c1-13(12(16)17,23(18,19)20)10(11(14)15)7-4-5-8(21-2)9(6-7)22-3/h4-6,10H,1-3H3,(H,14,15)(H,16,17)(H2,18,19,20) |
| InChIKey | CHRFCPPGOJZUDF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|