C11H16BrO5P — CID 88731355
[bromo-(3,4-dimethoxyphenyl)methyl]-ethoxyphosphinic acid (PubChem CID 88731355) has the molecular formula C11H16BrO5P and a molecular weight of 339.12 g/mol. Its IUPAC name is [bromo-(3,4-dimethoxyphenyl)methyl]-ethoxyphosphinic acid.
| Compound Name | [bromo-(3,4-dimethoxyphenyl)methyl]-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 88731355 |
| Molecular Formula | C11H16BrO5P |
| Molecular Weight | 339.12 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | [bromo-(3,4-dimethoxyphenyl)methyl]-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)C(Br)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C11H16BrO5P/c1-4-17-18(13,14)11(12)8-5-6-9(15-2)10(7-8)16-3/h5-7,11H,4H2,1-3H3,(H,13,14) |
| InChIKey | QCASANXZIUOHIF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.12 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|