C21H29O8P — CID 162399742
2-[diethoxyphosphoryl-(3,4-dimethoxyphenyl)methyl]-4,5-dimethoxyphenol (PubChem CID 162399742) has the molecular formula C21H29O8P and a molecular weight of 440.43 g/mol. Its IUPAC name is 2-[diethoxyphosphoryl-(3,4-dimethoxyphenyl)methyl]-4,5-dimethoxyphenol.
| Compound Name | 2-[diethoxyphosphoryl-(3,4-dimethoxyphenyl)methyl]-4,5-dimethoxyphenol |
|---|---|
| PubChem CID | 162399742 |
| Molecular Formula | C21H29O8P |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-[diethoxyphosphoryl-(3,4-dimethoxyphenyl)methyl]-4,5-dimethoxyphenol |
| SMILES | CCOP(=O)(OCC)C(c1ccc(OC)c(OC)c1)c1cc(OC)c(OC)cc1O |
| InChI | InChI=1S/C21H29O8P/c1-7-28-30(23,29-8-2)21(14-9-10-17(24-3)18(11-14)25-4)15-12-19(26-5)20(27-6)13-16(15)22/h9-13,21-22H,7-8H2,1-6H3 |
| InChIKey | JXJXZCSAFDTWMZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|