C20H25O8P — CID 162399642
6-[diethoxyphosphoryl-(3,4-dimethoxyphenyl)methyl]-1,3-benzodioxol-5-ol (PubChem CID 162399642) has the molecular formula C20H25O8P and a molecular weight of 424.39 g/mol. Its IUPAC name is 6-[diethoxyphosphoryl-(3,4-dimethoxyphenyl)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[diethoxyphosphoryl-(3,4-dimethoxyphenyl)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 162399642 |
| Molecular Formula | C20H25O8P |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 6-[diethoxyphosphoryl-(3,4-dimethoxyphenyl)methyl]-1,3-benzodioxol-5-ol |
| SMILES | CCOP(=O)(OCC)C(c1ccc(OC)c(OC)c1)c1cc2c(cc1O)OCO2 |
| InChI | InChI=1S/C20H25O8P/c1-5-27-29(22,28-6-2)20(13-7-8-16(23-3)17(9-13)24-4)14-10-18-19(11-15(14)21)26-12-25-18/h7-11,20-21H,5-6,12H2,1-4H3 |
| InChIKey | HCFLBYMYFFABOC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|