C22H24O8 — CID 3783112
3-[(6-hydroxy-1,3-benzodioxol-5-yl)-(3,4,5-trimethoxyphenyl)methyl]pentane-2,4-dione (PubChem CID 3783112) has the molecular formula C22H24O8 and a molecular weight of 416.43 g/mol. Its IUPAC name is 3-[(6-hydroxy-1,3-benzodioxol-5-yl)-(3,4,5-trimethoxyphenyl)methyl]pentane-2,4-dione.
| Compound Name | 3-[(6-hydroxy-1,3-benzodioxol-5-yl)-(3,4,5-trimethoxyphenyl)methyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 3783112 |
| Molecular Formula | C22H24O8 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 3-[(6-hydroxy-1,3-benzodioxol-5-yl)-(3,4,5-trimethoxyphenyl)methyl]pentane-2,4-dione |
| SMILES | COc1cc(C(c2cc3c(cc2O)OCO3)C(C(C)=O)C(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C22H24O8/c1-11(23)20(12(2)24)21(14-8-16-17(9-15(14)25)30-10-29-16)13-6-18(26-3)22(28-5)19(7-13)27-4/h6-9,20-21,25H,10H2,1-5H3 |
| InChIKey | GMKHSYUHFXONSN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|