C20H18O9 — CID 7584095
(3R)-3-[(S)-(6-hydroxy-1,3-benzodioxol-5-yl)-(4-hydroxy-3,5-dimethoxyphenyl)methyl]oxolane-2,4-dione (PubChem CID 7584095) has the molecular formula C20H18O9 and a molecular weight of 402.36 g/mol. Its IUPAC name is (3R)-3-[(S)-(6-hydroxy-1,3-benzodioxol-5-yl)-(4-hydroxy-3,5-dimethoxyphenyl)methyl]oxolane-2,4-dione.
| Compound Name | (3R)-3-[(S)-(6-hydroxy-1,3-benzodioxol-5-yl)-(4-hydroxy-3,5-dimethoxyphenyl)methyl]oxolane-2,4-dione |
|---|---|
| PubChem CID | 7584095 |
| Molecular Formula | C20H18O9 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (3R)-3-[(S)-(6-hydroxy-1,3-benzodioxol-5-yl)-(4-hydroxy-3,5-dimethoxyphenyl)methyl]oxolane-2,4-dione |
| SMILES | COc1cc([C@@H](c2cc3c(cc2O)OCO3)[C@@H]2C(=O)COC2=O)cc(OC)c1O |
| InChI | InChI=1S/C20H18O9/c1-25-15-3-9(4-16(26-2)19(15)23)17(18-12(22)7-27-20(18)24)10-5-13-14(6-11(10)21)29-8-28-13/h3-6,17-18,21,23H,7-8H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | RMAFJZMXRHMDQK-ROUUACIJSA-N |
| XLogP | 1.72 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|