C19H17N3O5 — CID 6992772
6-[(S)-(2-hydroxy-3-methoxyphenyl)-(pyrimidin-2-ylamino)methyl]-1,3-benzodioxol-5-ol (PubChem CID 6992772) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is 6-[(S)-(2-hydroxy-3-methoxyphenyl)-(pyrimidin-2-ylamino)methyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(S)-(2-hydroxy-3-methoxyphenyl)-(pyrimidin-2-ylamino)methyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 6992772 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 6-[(S)-(2-hydroxy-3-methoxyphenyl)-(pyrimidin-2-ylamino)methyl]-1,3-benzodioxol-5-ol |
| SMILES | COc1cccc([C@@H](Nc2ncccn2)c2cc3c(cc2O)OCO3)c1O |
| InChI | InChI=1S/C19H17N3O5/c1-25-14-5-2-4-11(18(14)24)17(22-19-20-6-3-7-21-19)12-8-15-16(9-13(12)23)27-10-26-15/h2-9,17,23-24H,10H2,1H3,(H,20,21,22)/t17-/m1/s1 |
| InChIKey | CCSRPHARXGJWSH-QGZVFWFLSA-N |
| XLogP | 2.83 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|