About 6-[1-(2-methoxyphenyl)-5-morpholin-4-ylpentyl]-1,3-benzodioxol-5-ol
6-[1-(2-methoxyphenyl)-5-morpholin-4-ylpentyl]-1,3-benzodioxol-5-ol (PubChem CID 167151964) has the molecular formula C23H29NO5
and a molecular weight of 399.49 g/mol. Its IUPAC name is 6-[1-(2-methoxyphenyl)-5-morpholin-4-ylpentyl]-1,3-benzodioxol-5-ol.
Molecular Properties
| Compound Name | 6-[1-(2-methoxyphenyl)-5-morpholin-4-ylpentyl]-1,3-benzodioxol-5-ol |
| PubChem CID | 167151964 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 6-[1-(2-methoxyphenyl)-5-morpholin-4-ylpentyl]-1,3-benzodioxol-5-ol |
| SMILES | COc1ccccc1C(CCCCN1CCOCC1)c1cc2c(cc1O)OCO2 |
| InChI | InChI=1S/C23H29NO5/c1-26-21-8-3-2-7-18(21)17(6-4-5-9-24-10-12-27-13-11-24)19-14-22-23(15-20(19)25)29-16-28-22/h2-3,7-8,14-15,17,25H,4-6,9-13,16H2,1H3 |
| InChIKey | MEACWCXRQMOWQV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[1-(2-methoxyphenyl)-5-morpholin-4-ylpentyl]-1,3-benzodioxol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(2-methoxyphenyl)-5-morpholin-4-ylpentyl]-1,3-benzodioxol-5-ol?
The IUPAC name of 6-[1-(2-methoxyphenyl)-5-morpholin-4-ylpentyl]-1,3-benzodioxol-5-ol (CID 167151964) is 6-[1-(2-methoxyphenyl)-5-morpholin-4-ylpentyl]-1,3-benzodioxol-5-ol.
What is the SMILES notation for 6-[1-(2-methoxyphenyl)-5-morpholin-4-ylpentyl]-1,3-benzodioxol-5-ol?
The canonical SMILES for 6-[1-(2-methoxyphenyl)-5-morpholin-4-ylpentyl]-1,3-benzodioxol-5-ol is COc1ccccc1C(CCCCN1CCOCC1)c1cc2c(cc1O)OCO2.
What is the InChIKey of 6-[1-(2-methoxyphenyl)-5-morpholin-4-ylpentyl]-1,3-benzodioxol-5-ol?
The InChIKey is MEACWCXRQMOWQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29NO5/c1-26-21-8-3-2-7-18(21)17(6-4-5-9-24-10-12-27-13-11-24)19-14-22-23(15-20(19)25)29-16-28-22/h2-3,7-8,14-15,17,25H,4-6,9-13,16H2,1H3.
What are the key properties of 6-[1-(2-methoxyphenyl)-5-morpholin-4-ylpentyl]-1,3-benzodioxol-5-ol?
6-[1-(2-methoxyphenyl)-5-morpholin-4-ylpentyl]-1,3-benzodioxol-5-ol has a molecular weight of 399.49 g/mol, XLogP of 3.76, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(2-methoxyphenyl)-5-morpholin-4-ylpentyl]-1,3-benzodioxol-5-ol is sourced from PubChem (CID 167151964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).