C25H26O3 — CID 167679878
5-[(1S)-1-(2-methoxyphenyl)-5-phenylpentyl]-1,3-benzodioxole (PubChem CID 167679878) has the molecular formula C25H26O3 and a molecular weight of 374.48 g/mol. Its IUPAC name is 5-[(1S)-1-(2-methoxyphenyl)-5-phenylpentyl]-1,3-benzodioxole.
| Compound Name | 5-[(1S)-1-(2-methoxyphenyl)-5-phenylpentyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 167679878 |
| Molecular Formula | C25H26O3 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 5-[(1S)-1-(2-methoxyphenyl)-5-phenylpentyl]-1,3-benzodioxole |
| SMILES | COc1ccccc1[C@@H](CCCCc1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H26O3/c1-26-23-14-8-7-13-22(23)21(12-6-5-11-19-9-3-2-4-10-19)20-15-16-24-25(17-20)28-18-27-24/h2-4,7-10,13-17,21H,5-6,11-12,18H2,1H3/t21-/m0/s1 |
| InChIKey | ZHDJSYICQQAWJY-NRFANRHFSA-N |
| XLogP | 5.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|