C23H24NO2+ — CID 7317147
[(3S)-3-(1,3-benzodioxol-5-yl)-3-phenylpropyl]-benzylazanium (PubChem CID 7317147) has the molecular formula C23H24NO2+ and a molecular weight of 346.45 g/mol. Its IUPAC name is [(3S)-3-(1,3-benzodioxol-5-yl)-3-phenylpropyl]-benzylazanium.
| Compound Name | [(3S)-3-(1,3-benzodioxol-5-yl)-3-phenylpropyl]-benzylazanium |
|---|---|
| PubChem CID | 7317147 |
| Molecular Formula | C23H24NO2+ |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [(3S)-3-(1,3-benzodioxol-5-yl)-3-phenylpropyl]-benzylazanium |
| SMILES | c1ccc(C[NH2+]CC[C@@H](c2ccccc2)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C23H23NO2/c1-3-7-18(8-4-1)16-24-14-13-21(19-9-5-2-6-10-19)20-11-12-22-23(15-20)26-17-25-22/h1-12,15,21,24H,13-14,16-17H2/p+1/t21-/m0/s1 |
| InChIKey | DXIZNVHVLWVQIJ-NRFANRHFSA-O |
| XLogP | 3.70 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|