C17H20NO3+ — CID 7082120
[(3S)-3-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)propyl]azanium (PubChem CID 7082120) has the molecular formula C17H20NO3+ and a molecular weight of 286.35 g/mol. Its IUPAC name is [(3S)-3-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)propyl]azanium.
| Compound Name | [(3S)-3-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)propyl]azanium |
|---|---|
| PubChem CID | 7082120 |
| Molecular Formula | C17H20NO3+ |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | [(3S)-3-(1,3-benzodioxol-5-yl)-3-(4-methoxyphenyl)propyl]azanium |
| SMILES | COc1ccc([C@H](CC[NH3+])c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H19NO3/c1-19-14-5-2-12(3-6-14)15(8-9-18)13-4-7-16-17(10-13)21-11-20-16/h2-7,10,15H,8-9,11,18H2,1H3/p+1/t15-/m0/s1 |
| InChIKey | GLFPYQXFXMAJMD-HNNXBMFYSA-O |
| XLogP | 2.19 |
| TPSA | 55.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |