C16H17NO4 — CID 61045491
2-(1,3-benzodioxol-5-yl)-2-(4-methoxyanilino)ethanol (PubChem CID 61045491) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-(4-methoxyanilino)ethanol.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2-(4-methoxyanilino)ethanol |
|---|---|
| PubChem CID | 61045491 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2-(4-methoxyanilino)ethanol |
| SMILES | COc1ccc(NC(CO)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C16H17NO4/c1-19-13-5-3-12(4-6-13)17-14(9-18)11-2-7-15-16(8-11)21-10-20-15/h2-8,14,17-18H,9-10H2,1H3 |
| InChIKey | YHEPDYSQCLKVSJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|