C10H12O4 — CID 102028593
(2S)-2-(1,3-benzodioxol-5-yl)-2-methoxyethanol (PubChem CID 102028593) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is (2S)-2-(1,3-benzodioxol-5-yl)-2-methoxyethanol.
| Compound Name | (2S)-2-(1,3-benzodioxol-5-yl)-2-methoxyethanol |
|---|---|
| PubChem CID | 102028593 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (2S)-2-(1,3-benzodioxol-5-yl)-2-methoxyethanol |
| SMILES | CO[C@H](CO)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H12O4/c1-12-10(5-11)7-2-3-8-9(4-7)14-6-13-8/h2-4,10-11H,5-6H2,1H3/t10-/m1/s1 |
| InChIKey | AUUSJZKVLVNYSO-SNVBAGLBSA-N |
| XLogP | 1.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |