C20H24O6 — CID 54128064
2-(1,3-benzodioxol-5-yl)-2-[4-(methylperoxymethyl)-2-propylphenoxy]ethanol (PubChem CID 54128064) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-[4-(methylperoxymethyl)-2-propylphenoxy]ethanol.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2-[4-(methylperoxymethyl)-2-propylphenoxy]ethanol |
|---|---|
| PubChem CID | 54128064 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2-[4-(methylperoxymethyl)-2-propylphenoxy]ethanol |
| SMILES | CCCc1cc(COOC)ccc1OC(CO)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H24O6/c1-3-4-15-9-14(12-25-22-2)5-7-17(15)26-20(11-21)16-6-8-18-19(10-16)24-13-23-18/h5-10,20-21H,3-4,11-13H2,1-2H3 |
| InChIKey | NSJNCXDFDLKRGF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|