C23H34N2O9 — CID 89446871
7-(2-hydroxy-1-methoxyethyl)-4,11,17,20,25-pentaoxa-1,14-diazatricyclo[12.8.5.05,10]heptacosa-5(10),6,8-triene-2,13-dione (PubChem CID 89446871) has the molecular formula C23H34N2O9 and a molecular weight of 482.53 g/mol. Its IUPAC name is 7-(2-hydroxy-1-methoxyethyl)-4,11,17,20,25-pentaoxa-1,14-diazatricyclo[12.8.5.05,10]heptacosa-5(10),6,8-triene-2,13-dione.
| Compound Name | 7-(2-hydroxy-1-methoxyethyl)-4,11,17,20,25-pentaoxa-1,14-diazatricyclo[12.8.5.05,10]heptacosa-5(10),6,8-triene-2,13-dione |
|---|---|
| PubChem CID | 89446871 |
| Molecular Formula | C23H34N2O9 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 7-(2-hydroxy-1-methoxyethyl)-4,11,17,20,25-pentaoxa-1,14-diazatricyclo[12.8.5.05,10]heptacosa-5(10),6,8-triene-2,13-dione |
| SMILES | COC(CO)c1ccc2c(c1)OCC(=O)N1CCOCCOCCN(CCOCC1)C(=O)CO2 |
| InChI | InChI=1S/C23H34N2O9/c1-29-21(15-26)18-2-3-19-20(14-18)34-17-23(28)25-5-9-30-8-4-24(22(27)16-33-19)6-10-31-12-13-32-11-7-25/h2-3,14,21,26H,4-13,15-17H2,1H3 |
| InChIKey | KFKFPGUOOHXDBM-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|