C19H28N3O7+ — CID 7285646
N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ium-4-ylethyl]-N'-(2,2-dimethoxyethyl)oxamide (PubChem CID 7285646) has the molecular formula C19H28N3O7+ and a molecular weight of 410.45 g/mol. Its IUPAC name is N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ium-4-ylethyl]-N'-(2,2-dimethoxyethyl)oxamide.
| Compound Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ium-4-ylethyl]-N'-(2,2-dimethoxyethyl)oxamide |
|---|---|
| PubChem CID | 7285646 |
| Molecular Formula | C19H28N3O7+ |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ium-4-ylethyl]-N'-(2,2-dimethoxyethyl)oxamide |
| SMILES | COC(CNC(=O)C(=O)NC[C@H](c1ccc2c(c1)OCO2)[NH+]1CCOCC1)OC |
| InChI | InChI=1S/C19H27N3O7/c1-25-17(26-2)11-21-19(24)18(23)20-10-14(22-5-7-27-8-6-22)13-3-4-15-16(9-13)29-12-28-15/h3-4,9,14,17H,5-8,10-12H2,1-2H3,(H,20,23)(H,21,24)/p+1/t14-/m1/s1 |
| InChIKey | JYOFAQOBSOHDAP-CQSZACIVSA-O |
| XLogP | -1.78 |
| TPSA | 108.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|