C22H26N3O5+ — CID 7280717
N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ium-4-ylethyl]-N'-(4-methylphenyl)oxamide (PubChem CID 7280717) has the molecular formula C22H26N3O5+ and a molecular weight of 412.47 g/mol. Its IUPAC name is N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ium-4-ylethyl]-N'-(4-methylphenyl)oxamide.
| Compound Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ium-4-ylethyl]-N'-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 7280717 |
| Molecular Formula | C22H26N3O5+ |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ium-4-ylethyl]-N'-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NC[C@H](c2ccc3c(c2)OCO3)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C22H25N3O5/c1-15-2-5-17(6-3-15)24-22(27)21(26)23-13-18(25-8-10-28-11-9-25)16-4-7-19-20(12-16)30-14-29-19/h2-7,12,18H,8-11,13-14H2,1H3,(H,23,26)(H,24,27)/p+1/t18-/m1/s1 |
| InChIKey | XYGHGXUSZDFTRT-GOSISDBHSA-O |
| XLogP | 0.43 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|