C22H32N3O5+ — CID 7285730
N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ium-4-ylethyl]-N'-cycloheptyloxamide (PubChem CID 7285730) has the molecular formula C22H32N3O5+ and a molecular weight of 418.51 g/mol. Its IUPAC name is N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ium-4-ylethyl]-N'-cycloheptyloxamide.
| Compound Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ium-4-ylethyl]-N'-cycloheptyloxamide |
|---|---|
| PubChem CID | 7285730 |
| Molecular Formula | C22H32N3O5+ |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ium-4-ylethyl]-N'-cycloheptyloxamide |
| SMILES | O=C(NC[C@H](c1ccc2c(c1)OCO2)[NH+]1CCOCC1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C22H31N3O5/c26-21(22(27)24-17-5-3-1-2-4-6-17)23-14-18(25-9-11-28-12-10-25)16-7-8-19-20(13-16)30-15-29-19/h7-8,13,17-18H,1-6,9-12,14-15H2,(H,23,26)(H,24,27)/p+1/t18-/m1/s1 |
| InChIKey | QDHNWOYYHUOXJG-GOSISDBHSA-O |
| XLogP | 0.33 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|