C20H24N3O6+ — CID 7217231
N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2S)-2-(furan-2-yl)-2-morpholin-4-ium-4-ylethyl]oxamide (PubChem CID 7217231) has the molecular formula C20H24N3O6+ and a molecular weight of 402.43 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2S)-2-(furan-2-yl)-2-morpholin-4-ium-4-ylethyl]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2S)-2-(furan-2-yl)-2-morpholin-4-ium-4-ylethyl]oxamide |
|---|---|
| PubChem CID | 7217231 |
| Molecular Formula | C20H24N3O6+ |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2S)-2-(furan-2-yl)-2-morpholin-4-ium-4-ylethyl]oxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C(=O)NC[C@@H](c1ccco1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C20H23N3O6/c24-19(21-11-14-3-4-17-18(10-14)29-13-28-17)20(25)22-12-15(16-2-1-7-27-16)23-5-8-26-9-6-23/h1-4,7,10,15H,5-6,8-9,11-13H2,(H,21,24)(H,22,25)/p+1/t15-/m0/s1 |
| InChIKey | GMNOZFBIKKQSSY-HNNXBMFYSA-O |
| XLogP | -0.60 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|