C20H21N3O5 — CID 108508569
N-(1,3-benzodioxol-5-ylmethyl)-N'-(2-morpholin-4-ylphenyl)oxamide (PubChem CID 108508569) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-(2-morpholin-4-ylphenyl)oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(2-morpholin-4-ylphenyl)oxamide |
|---|---|
| PubChem CID | 108508569 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(2-morpholin-4-ylphenyl)oxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C(=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C20H21N3O5/c24-19(21-12-14-5-6-17-18(11-14)28-13-27-17)20(25)22-15-3-1-2-4-16(15)23-7-9-26-10-8-23/h1-6,11H,7-10,12-13H2,(H,21,24)(H,22,25) |
| InChIKey | QAHJGAAKHPIVJC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|