C24H29N3O7 — CID 171668708
N-[2-(azepan-1-yl)phenyl]-2-(1,3-benzodioxol-5-ylmethylamino)acetamide;oxalic acid (PubChem CID 171668708) has the molecular formula C24H29N3O7 and a molecular weight of 471.51 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)phenyl]-2-(1,3-benzodioxol-5-ylmethylamino)acetamide;oxalic acid.
| Compound Name | N-[2-(azepan-1-yl)phenyl]-2-(1,3-benzodioxol-5-ylmethylamino)acetamide;oxalic acid |
|---|---|
| PubChem CID | 171668708 |
| Molecular Formula | C24H29N3O7 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | N-[2-(azepan-1-yl)phenyl]-2-(1,3-benzodioxol-5-ylmethylamino)acetamide;oxalic acid |
| SMILES | O=C(CNCc1ccc2c(c1)OCO2)Nc1ccccc1N1CCCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H27N3O3.C2H2O4/c26-22(15-23-14-17-9-10-20-21(13-17)28-16-27-20)24-18-7-3-4-8-19(18)25-11-5-1-2-6-12-25;3-1(4)2(5)6/h3-4,7-10,13,23H,1-2,5-6,11-12,14-16H2,(H,24,26);(H,3,4)(H,5,6) |
| InChIKey | ZAFUTCGMMCYPNY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|