C20H31N3O5 — CID 171668727
2-(3-methylbutylamino)-N-(2-piperidin-1-ylphenyl)acetamide;oxalic acid (PubChem CID 171668727) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is 2-(3-methylbutylamino)-N-(2-piperidin-1-ylphenyl)acetamide;oxalic acid.
| Compound Name | 2-(3-methylbutylamino)-N-(2-piperidin-1-ylphenyl)acetamide;oxalic acid |
|---|---|
| PubChem CID | 171668727 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 2-(3-methylbutylamino)-N-(2-piperidin-1-ylphenyl)acetamide;oxalic acid |
| SMILES | CC(C)CCNCC(=O)Nc1ccccc1N1CCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H29N3O.C2H2O4/c1-15(2)10-11-19-14-18(22)20-16-8-4-5-9-17(16)21-12-6-3-7-13-21;3-1(4)2(5)6/h4-5,8-9,15,19H,3,6-7,10-14H2,1-2H3,(H,20,22);(H,3,4)(H,5,6) |
| InChIKey | OXSUPPMQJNNEDB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|