C23H36N4O5 — CID 175652876
N-[2-(azepan-1-yl)phenyl]-2-(2-piperidin-1-ylethylamino)acetamide;oxalic acid (PubChem CID 175652876) has the molecular formula C23H36N4O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)phenyl]-2-(2-piperidin-1-ylethylamino)acetamide;oxalic acid.
| Compound Name | N-[2-(azepan-1-yl)phenyl]-2-(2-piperidin-1-ylethylamino)acetamide;oxalic acid |
|---|---|
| PubChem CID | 175652876 |
| Molecular Formula | C23H36N4O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | N-[2-(azepan-1-yl)phenyl]-2-(2-piperidin-1-ylethylamino)acetamide;oxalic acid |
| SMILES | O=C(CNCCN1CCCCC1)Nc1ccccc1N1CCCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H34N4O.C2H2O4/c26-21(18-22-12-17-24-13-6-3-7-14-24)23-19-10-4-5-11-20(19)25-15-8-1-2-9-16-25;3-1(4)2(5)6/h4-5,10-11,22H,1-3,6-9,12-18H2,(H,23,26);(H,3,4)(H,5,6) |
| InChIKey | GCUSSAJRUXTRIV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|