C15H12ClN3O4 — CID 44999738
N-(1,3-benzodioxol-5-ylmethyl)-N'-(2-chloro-3-pyridinyl)oxamide (PubChem CID 44999738) has the molecular formula C15H12ClN3O4 and a molecular weight of 333.73 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-(2-chloro-3-pyridinyl)oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(2-chloro-3-pyridinyl)oxamide |
|---|---|
| PubChem CID | 44999738 |
| Molecular Formula | C15H12ClN3O4 |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(2-chloro-3-pyridinyl)oxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C15H12ClN3O4/c16-13-10(2-1-5-17-13)19-15(21)14(20)18-7-9-3-4-11-12(6-9)23-8-22-11/h1-6H,7-8H2,(H,18,20)(H,19,21) |
| InChIKey | YHKRVHYTMXQULH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|