C14H11BrN2O3 — CID 107518056
N-(1,3-benzodioxol-5-ylmethyl)-3-bromopyridine-2-carboxamide (PubChem CID 107518056) has the molecular formula C14H11BrN2O3 and a molecular weight of 335.16 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-bromopyridine-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-bromopyridine-2-carboxamide |
|---|---|
| PubChem CID | 107518056 |
| Molecular Formula | C14H11BrN2O3 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-bromopyridine-2-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ncccc1Br |
| InChI | InChI=1S/C14H11BrN2O3/c15-10-2-1-5-16-13(10)14(18)17-7-9-3-4-11-12(6-9)20-8-19-11/h1-6H,7-8H2,(H,17,18) |
| InChIKey | SLIXIVMTDJJLDN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |