C20H25ClN4O3+2 — CID 9444454
(2R)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-chloro-3-pyridinyl)propanamide (PubChem CID 9444454) has the molecular formula C20H25ClN4O3+2 and a molecular weight of 404.90 g/mol. Its IUPAC name is (2R)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-chloro-3-pyridinyl)propanamide.
| Compound Name | (2R)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-chloro-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 9444454 |
| Molecular Formula | C20H25ClN4O3+2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (2R)-2-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-chloro-3-pyridinyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1cccnc1Cl)[NH+]1CC[NH+](Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C20H23ClN4O3/c1-14(20(26)23-16-3-2-6-22-19(16)21)25-9-7-24(8-10-25)12-15-4-5-17-18(11-15)28-13-27-17/h2-6,11,14H,7-10,12-13H2,1H3,(H,23,26)/p+2/t14-/m1/s1 |
| InChIKey | LSVGFVGYYBADFD-CQSZACIVSA-P |
| XLogP | -0.23 |
| TPSA | 69.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|