C22H28ClN3O2+2 — CID 9126744
(2S)-N-(3-chlorophenyl)-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]propanamide (PubChem CID 9126744) has the molecular formula C22H28ClN3O2+2 and a molecular weight of 401.94 g/mol. Its IUPAC name is (2S)-N-(3-chlorophenyl)-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]propanamide.
| Compound Name | (2S)-N-(3-chlorophenyl)-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]propanamide |
|---|---|
| PubChem CID | 9126744 |
| Molecular Formula | C22H28ClN3O2+2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | (2S)-N-(3-chlorophenyl)-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1cccc(Cl)c1)[NH+]1CC[NH+](Cc2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C22H26ClN3O2/c1-16(22(27)24-20-4-2-3-19(23)14-20)26-10-8-25(9-11-26)15-17-5-6-21-18(13-17)7-12-28-21/h2-6,13-14,16H,7-12,15H2,1H3,(H,24,27)/p+2/t16-/m0/s1 |
| InChIKey | KGDNLJDWFMKQIP-INIZCTEOSA-P |
| XLogP | 0.59 |
| TPSA | 47.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|