C23H30ClN3O2+2 — CID 9127155
N-[(1R)-1-(4-chlorophenyl)ethyl]-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]acetamide (PubChem CID 9127155) has the molecular formula C23H30ClN3O2+2 and a molecular weight of 415.97 g/mol. Its IUPAC name is N-[(1R)-1-(4-chlorophenyl)ethyl]-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]acetamide.
| Compound Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]acetamide |
|---|---|
| PubChem CID | 9127155 |
| Molecular Formula | C23H30ClN3O2+2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]acetamide |
| SMILES | C[C@@H](NC(=O)C[NH+]1CC[NH+](Cc2ccc3c(c2)CCO3)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H28ClN3O2/c1-17(19-3-5-21(24)6-4-19)25-23(28)16-27-11-9-26(10-12-27)15-18-2-7-22-20(14-18)8-13-29-22/h2-7,14,17H,8-13,15-16H2,1H3,(H,25,28)/p+2/t17-/m1/s1 |
| InChIKey | JZQCESLTPCSYLY-QGZVFWFLSA-P |
| XLogP | 0.44 |
| TPSA | 47.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|