C24H33N3O2S+2 — CID 9127329
2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide (PubChem CID 9127329) has the molecular formula C24H33N3O2S+2 and a molecular weight of 427.61 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide.
| Compound Name | 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 9127329 |
| Molecular Formula | C24H33N3O2S+2 |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
| SMILES | Cc1ccc(SCCNC(=O)C[NH+]2CC[NH+](Cc3ccc4c(c3)CCO4)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O2S/c1-19-2-5-22(6-3-19)30-15-9-25-24(28)18-27-12-10-26(11-13-27)17-20-4-7-23-21(16-20)8-14-29-23/h2-7,16H,8-15,17-18H2,1H3,(H,25,28)/p+2 |
| InChIKey | DTGXNPAGSHWBMZ-UHFFFAOYSA-P |
| XLogP | 0.12 |
| TPSA | 47.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|