C21H26FN3O2+2 — CID 9126689
2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 9126689) has the molecular formula C21H26FN3O2+2 and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 9126689 |
| Molecular Formula | C21H26FN3O2+2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(C[NH+]1CC[NH+](Cc2ccc3c(c2)CCO3)CC1)Nc1ccccc1F |
| InChI | InChI=1S/C21H24FN3O2/c22-18-3-1-2-4-19(18)23-21(26)15-25-10-8-24(9-11-25)14-16-5-6-20-17(13-16)7-12-27-20/h1-6,13H,7-12,14-15H2,(H,23,26)/p+2 |
| InChIKey | NBAZINDQXKKVDH-UHFFFAOYSA-P |
| XLogP | -0.32 |
| TPSA | 47.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|