C24H33N3O2+2 — CID 9126768
2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-ethyl-6-methylphenyl)acetamide (PubChem CID 9126768) has the molecular formula C24H33N3O2+2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-ethyl-6-methylphenyl)acetamide.
| Compound Name | 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-ethyl-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 9126768 |
| Molecular Formula | C24H33N3O2+2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-ethyl-6-methylphenyl)acetamide |
| SMILES | CCc1cccc(C)c1NC(=O)C[NH+]1CC[NH+](Cc2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C24H31N3O2/c1-3-20-6-4-5-18(2)24(20)25-23(28)17-27-12-10-26(11-13-27)16-19-7-8-22-21(15-19)9-14-29-22/h4-8,15H,3,9-14,16-17H2,1-2H3,(H,25,28)/p+2 |
| InChIKey | QWTRQBANIQXQDY-UHFFFAOYSA-P |
| XLogP | 0.41 |
| TPSA | 47.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|