C23H31N3O2+2 — CID 9126593
2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(3,5-dimethylphenyl)acetamide (PubChem CID 9126593) has the molecular formula C23H31N3O2+2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(3,5-dimethylphenyl)acetamide.
| Compound Name | 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(3,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 9126593 |
| Molecular Formula | C23H31N3O2+2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(3,5-dimethylphenyl)acetamide |
| SMILES | Cc1cc(C)cc(NC(=O)C[NH+]2CC[NH+](Cc3ccc4c(c3)CCO4)CC2)c1 |
| InChI | InChI=1S/C23H29N3O2/c1-17-11-18(2)13-21(12-17)24-23(27)16-26-8-6-25(7-9-26)15-19-3-4-22-20(14-19)5-10-28-22/h3-4,11-14H,5-10,15-16H2,1-2H3,(H,24,27)/p+2 |
| InChIKey | PPSXBJYCZGUNAT-UHFFFAOYSA-P |
| XLogP | 0.16 |
| TPSA | 47.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|