C21H29N3O2S+2 — CID 9127256
2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 9127256) has the molecular formula C21H29N3O2S+2 and a molecular weight of 387.55 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 9127256 |
| Molecular Formula | C21H29N3O2S+2 |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(C[NH+]1CC[NH+](Cc2ccc3c(c2)CCO3)CC1)NCCc1cccs1 |
| InChI | InChI=1S/C21H27N3O2S/c25-21(22-7-5-19-2-1-13-27-19)16-24-10-8-23(9-11-24)15-17-3-4-20-18(14-17)6-12-26-20/h1-4,13-14H,5-12,15-16H2,(H,22,25)/p+2 |
| InChIKey | VSRQYUKLRQVKFA-UHFFFAOYSA-P |
| XLogP | -0.67 |
| TPSA | 47.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|