C22H28N2O3+2 — CID 9127129
methyl 3-[[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]methyl]benzoate (PubChem CID 9127129) has the molecular formula C22H28N2O3+2 and a molecular weight of 368.48 g/mol. Its IUPAC name is methyl 3-[[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 9127129 |
| Molecular Formula | C22H28N2O3+2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | methyl 3-[[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(C[NH+]2CC[NH+](Cc3ccc4c(c3)CCO4)CC2)c1 |
| InChI | InChI=1S/C22H26N2O3/c1-26-22(25)20-4-2-3-17(14-20)15-23-8-10-24(11-9-23)16-18-5-6-21-19(13-18)7-12-27-21/h2-6,13-14H,7-12,15-16H2,1H3/p+2 |
| InChIKey | VCPNMQHGGFEQER-UHFFFAOYSA-P |
| XLogP | -0.11 |
| TPSA | 44.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|