C24H31N3O2+2 — CID 9127245
(2R)-N-cyclopropyl-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-2-phenylacetamide (PubChem CID 9127245) has the molecular formula C24H31N3O2+2 and a molecular weight of 393.53 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-2-phenylacetamide.
| Compound Name | (2R)-N-cyclopropyl-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 9127245 |
| Molecular Formula | C24H31N3O2+2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | (2R)-N-cyclopropyl-2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]-2-phenylacetamide |
| SMILES | O=C(NC1CC1)[C@@H](c1ccccc1)[NH+]1CC[NH+](Cc2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C24H29N3O2/c28-24(25-21-7-8-21)23(19-4-2-1-3-5-19)27-13-11-26(12-14-27)17-18-6-9-22-20(16-18)10-15-29-22/h1-6,9,16,21,23H,7-8,10-15,17H2,(H,25,28)/p+2/t23-/m1/s1 |
| InChIKey | YEMAMQUDROOXFT-HSZRJFAPSA-P |
| XLogP | -0.08 |
| TPSA | 47.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|