C21H28N2O4S+2 — CID 9126882
phenyl 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]ethanesulfonate (PubChem CID 9126882) has the molecular formula C21H28N2O4S+2 and a molecular weight of 404.53 g/mol. Its IUPAC name is phenyl 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]ethanesulfonate.
| Compound Name | phenyl 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 9126882 |
| Molecular Formula | C21H28N2O4S+2 |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | phenyl 2-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]ethanesulfonate |
| SMILES | O=S(=O)(CC[NH+]1CC[NH+](Cc2ccc3c(c2)CCO3)CC1)Oc1ccccc1 |
| InChI | InChI=1S/C21H26N2O4S/c24-28(25,27-20-4-2-1-3-5-20)15-13-22-9-11-23(12-10-22)17-18-6-7-21-19(16-18)8-14-26-21/h1-7,16H,8-15,17H2/p+2 |
| InChIKey | PDVVHUGGRZOZFW-UHFFFAOYSA-P |
| XLogP | -0.69 |
| TPSA | 61.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|