C25H30N2O3+2 — CID 9324179
1-[[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]methyl]-7-methoxynaphthalen-2-ol (PubChem CID 9324179) has the molecular formula C25H30N2O3+2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-[[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]methyl]-7-methoxynaphthalen-2-ol.
| Compound Name | 1-[[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]methyl]-7-methoxynaphthalen-2-ol |
|---|---|
| PubChem CID | 9324179 |
| Molecular Formula | C25H30N2O3+2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 1-[[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1,4-diium-1-yl]methyl]-7-methoxynaphthalen-2-ol |
| SMILES | COc1ccc2ccc(O)c(C[NH+]3CC[NH+](Cc4ccc5c(c4)CCO5)CC3)c2c1 |
| InChI | InChI=1S/C25H28N2O3/c1-29-21-5-3-19-4-6-24(28)23(22(19)15-21)17-27-11-9-26(10-12-27)16-18-2-7-25-20(14-18)8-13-30-25/h2-7,14-15,28H,8-13,16-17H2,1H3/p+2 |
| InChIKey | XGIVUACPTPGNAX-UHFFFAOYSA-P |
| XLogP | 0.97 |
| TPSA | 47.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|