C21H26N2O2S+2 — CID 8892910
7-methoxy-1-[[4-(thiophen-2-ylmethyl)piperazine-1,4-diium-1-yl]methyl]naphthalen-2-ol (PubChem CID 8892910) has the molecular formula C21H26N2O2S+2 and a molecular weight of 370.52 g/mol. Its IUPAC name is 7-methoxy-1-[[4-(thiophen-2-ylmethyl)piperazine-1,4-diium-1-yl]methyl]naphthalen-2-ol.
| Compound Name | 7-methoxy-1-[[4-(thiophen-2-ylmethyl)piperazine-1,4-diium-1-yl]methyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 8892910 |
| Molecular Formula | C21H26N2O2S+2 |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 7-methoxy-1-[[4-(thiophen-2-ylmethyl)piperazine-1,4-diium-1-yl]methyl]naphthalen-2-ol |
| SMILES | COc1ccc2ccc(O)c(C[NH+]3CC[NH+](Cc4cccs4)CC3)c2c1 |
| InChI | InChI=1S/C21H24N2O2S/c1-25-17-6-4-16-5-7-21(24)20(19(16)13-17)15-23-10-8-22(9-11-23)14-18-3-2-12-26-18/h2-7,12-13,24H,8-11,14-15H2,1H3/p+2 |
| InChIKey | PZLZDVRJGQNGKI-UHFFFAOYSA-P |
| XLogP | 1.10 |
| TPSA | 38.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|