methyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate

C16H14O3 — CID 4131960

IUPACmethyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate
SMILESCOC(=O)c1cccc(-c2ccc3c(c2)CCO3)c1
InChIInChI=1S/C16H14O3/c1-18-16(17)14-4-2-3-11(10-14)12-5-6-15-13(9-12)7-8-19-15/h2-6,9-10H,7-8H2,1H3
InChIKeyVHDRSTUSOPQBGZ-UHFFFAOYSA-N
MW254.28 g/mol
LogP3.08
Rot. Bonds2

About methyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate

methyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate (PubChem CID 4131960) has the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. Its IUPAC name is methyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate.

Molecular Properties

Compound Namemethyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate
PubChem CID4131960
Molecular FormulaC16H14O3
Molecular Weight254.28 g/mol
Exact Mass254.09
IUPAC Namemethyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate
SMILESCOC(=O)c1cccc(-c2ccc3c(c2)CCO3)c1
InChIInChI=1S/C16H14O3/c1-18-16(17)14-4-2-3-11(10-14)12-5-6-15-13(9-12)7-8-19-15/h2-6,9-10H,7-8H2,1H3
InChIKeyVHDRSTUSOPQBGZ-UHFFFAOYSA-N
XLogP3.08
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.28
LogP ≤ 53.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate?
The IUPAC name of methyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate (CID 4131960) is methyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate.
What is the SMILES notation for methyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate?
The canonical SMILES for methyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate is COC(=O)c1cccc(-c2ccc3c(c2)CCO3)c1.
What is the InChIKey of methyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate?
The InChIKey is VHDRSTUSOPQBGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3/c1-18-16(17)14-4-2-3-11(10-14)12-5-6-15-13(9-12)7-8-19-15/h2-6,9-10H,7-8H2,1H3.
What are the key properties of methyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate?
methyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate has a molecular weight of 254.28 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,3-dihydro-1-benzofuran-5-yl)benzoate is sourced from PubChem (CID 4131960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).