C16H14O4 — CID 47160994
(2-methoxyphenyl) 2,3-dihydro-1-benzofuran-5-carboxylate (PubChem CID 47160994) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is (2-methoxyphenyl) 2,3-dihydro-1-benzofuran-5-carboxylate.
| Compound Name | (2-methoxyphenyl) 2,3-dihydro-1-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 47160994 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (2-methoxyphenyl) 2,3-dihydro-1-benzofuran-5-carboxylate |
| SMILES | COc1ccccc1OC(=O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H14O4/c1-18-14-4-2-3-5-15(14)20-16(17)12-6-7-13-11(10-12)8-9-19-13/h2-7,10H,8-9H2,1H3 |
| InChIKey | CUQQFUKBEJFLPC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|