C23H29NO3 — CID 141068958
1-(2,3-dihydro-1-benzofuran-5-yl)-5-[2-(2-methoxyphenyl)ethyl-methylamino]pentan-1-one (PubChem CID 141068958) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-5-[2-(2-methoxyphenyl)ethyl-methylamino]pentan-1-one.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-5-[2-(2-methoxyphenyl)ethyl-methylamino]pentan-1-one |
|---|---|
| PubChem CID | 141068958 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-5-[2-(2-methoxyphenyl)ethyl-methylamino]pentan-1-one |
| SMILES | COc1ccccc1CCN(C)CCCCC(=O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C23H29NO3/c1-24(15-12-18-7-3-4-9-22(18)26-2)14-6-5-8-21(25)19-10-11-23-20(17-19)13-16-27-23/h3-4,7,9-11,17H,5-6,8,12-16H2,1-2H3 |
| InChIKey | NMJWWXPOQCUDAY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|