C19H20O2 — CID 65441462
5-(2,3-dihydro-1-benzofuran-5-yl)-1-phenylpentan-1-one (PubChem CID 65441462) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-(2,3-dihydro-1-benzofuran-5-yl)-1-phenylpentan-1-one.
| Compound Name | 5-(2,3-dihydro-1-benzofuran-5-yl)-1-phenylpentan-1-one |
|---|---|
| PubChem CID | 65441462 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 5-(2,3-dihydro-1-benzofuran-5-yl)-1-phenylpentan-1-one |
| SMILES | O=C(CCCCc1ccc2c(c1)CCO2)c1ccccc1 |
| InChI | InChI=1S/C19H20O2/c20-18(16-7-2-1-3-8-16)9-5-4-6-15-10-11-19-17(14-15)12-13-21-19/h1-3,7-8,10-11,14H,4-6,9,12-13H2 |
| InChIKey | MAVOQJPASUJTIO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|