C17H15IO2 — CID 114974271
3-(2,3-dihydro-1-benzofuran-5-yl)-1-(3-iodophenyl)propan-1-one (PubChem CID 114974271) has the molecular formula C17H15IO2 and a molecular weight of 378.21 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-5-yl)-1-(3-iodophenyl)propan-1-one.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-1-(3-iodophenyl)propan-1-one |
|---|---|
| PubChem CID | 114974271 |
| Molecular Formula | C17H15IO2 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-1-(3-iodophenyl)propan-1-one |
| SMILES | O=C(CCc1ccc2c(c1)CCO2)c1cccc(I)c1 |
| InChI | InChI=1S/C17H15IO2/c18-15-3-1-2-13(11-15)16(19)6-4-12-5-7-17-14(10-12)8-9-20-17/h1-3,5,7,10-11H,4,6,8-9H2 |
| InChIKey | QJARGLONLPOVGP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|